C32H40F6N4O6 — CID 163202893
tert-butyl N-[(2R)-4-[2-[[3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-(2,4,5-trifluorophenyl)butanoyl]amino]ethylamino]-4-oxo-1-(2,4,5-trifluorophenyl)butan-2-yl]carbamate (PubChem CID 163202893) has the molecular formula C32H40F6N4O6 and a molecular weight of 690.68 g/mol. Its IUPAC name is tert-butyl N-[(2R)-4-[2-[[3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-(2,4,5-trifluorophenyl)butanoyl]amino]ethylamino]-4-oxo-1-(2,4,5-trifluorophenyl)butan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-4-[2-[[3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-(2,4,5-trifluorophenyl)butanoyl]amino]ethylamino]-4-oxo-1-(2,4,5-trifluorophenyl)butan-2-yl]carbamate |
|---|---|
| PubChem CID | 163202893 |
| Molecular Formula | C32H40F6N4O6 |
| Molecular Weight | 690.68 g/mol |
| Exact Mass | 690.29 |
| IUPAC Name | tert-butyl N-[(2R)-4-[2-[[3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-(2,4,5-trifluorophenyl)butanoyl]amino]ethylamino]-4-oxo-1-(2,4,5-trifluorophenyl)butan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(CC(=O)NCCNC(=O)C[C@@H](Cc1cc(F)c(F)cc1F)NC(=O)OC(C)(C)C)Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C32H40F6N4O6/c1-31(2,3)47-29(45)41-19(9-17-11-23(35)25(37)15-21(17)33)13-27(43)39-7-8-40-28(44)14-20(42-30(46)48-32(4,5)6)10-18-12-24(36)26(38)16-22(18)34/h11-12,15-16,19-20H,7-10,13-14H2,1-6H3,(H,39,43)(H,40,44)(H,41,45)(H,42,46)/t19-,20?/m1/s1 |
| InChIKey | PLVNTRPPFDLXJX-FIWHBWSRSA-N |
| XLogP | 5.11 |
| TPSA | 134.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.68 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|