C22H28F3N3O7 — CID 67377354
(2S,4S)-2-methyl-4-[[(3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-(2,4,5-trifluorophenyl)butanoyl]amino]pyrrolidine-1,2-dicarboxylic acid (PubChem CID 67377354) has the molecular formula C22H28F3N3O7 and a molecular weight of 503.47 g/mol. Its IUPAC name is (2S,4S)-2-methyl-4-[[(3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-(2,4,5-trifluorophenyl)butanoyl]amino]pyrrolidine-1,2-dicarboxylic acid.
| Compound Name | (2S,4S)-2-methyl-4-[[(3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-(2,4,5-trifluorophenyl)butanoyl]amino]pyrrolidine-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 67377354 |
| Molecular Formula | C22H28F3N3O7 |
| Molecular Weight | 503.47 g/mol |
| Exact Mass | 503.19 |
| IUPAC Name | (2S,4S)-2-methyl-4-[[(3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-(2,4,5-trifluorophenyl)butanoyl]amino]pyrrolidine-1,2-dicarboxylic acid |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC(=O)N[C@@H]1CN(C(=O)O)[C@](C)(C(=O)O)C1)Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C22H28F3N3O7/c1-21(2,3)35-19(32)27-12(5-11-6-15(24)16(25)8-14(11)23)7-17(29)26-13-9-22(4,18(30)31)28(10-13)20(33)34/h6,8,12-13H,5,7,9-10H2,1-4H3,(H,26,29)(H,27,32)(H,30,31)(H,33,34)/t12-,13+,22+/m1/s1 |
| InChIKey | HLHWPKPIYRWVKN-IFMYKAFSSA-N |
| XLogP | 2.64 |
| TPSA | 145.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.47 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|