C24H28F6N4O5 — CID 87107753
(1R)-5,6,8-trifluoro-1,3-dimethyl-7-[3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-(2,4,5-trifluorophenyl)butanoyl]-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazine-1-carboxylic acid (PubChem CID 87107753) has the molecular formula C24H28F6N4O5 and a molecular weight of 566.50 g/mol. Its IUPAC name is (1R)-5,6,8-trifluoro-1,3-dimethyl-7-[3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-(2,4,5-trifluorophenyl)butanoyl]-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazine-1-carboxylic acid.
| Compound Name | (1R)-5,6,8-trifluoro-1,3-dimethyl-7-[3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-(2,4,5-trifluorophenyl)butanoyl]-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazine-1-carboxylic acid |
|---|---|
| PubChem CID | 87107753 |
| Molecular Formula | C24H28F6N4O5 |
| Molecular Weight | 566.50 g/mol |
| Exact Mass | 566.20 |
| IUPAC Name | (1R)-5,6,8-trifluoro-1,3-dimethyl-7-[3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-(2,4,5-trifluorophenyl)butanoyl]-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazine-1-carboxylic acid |
| SMILES | CC1=N[C@@](C)(C(=O)O)C2C(F)N(C(=O)CC(Cc3cc(F)c(F)cc3F)NC(=O)OC(C)(C)C)C(F)C(F)N12 |
| InChI | InChI=1S/C24H28F6N4O5/c1-10-32-24(5,21(36)37)17-18(28)34(20(30)19(29)33(10)17)16(35)8-12(31-22(38)39-23(2,3)4)6-11-7-14(26)15(27)9-13(11)25/h7,9,12,17-20H,6,8H2,1-5H3,(H,31,38)(H,36,37)/t12?,17?,18?,19?,20?,24-/m1/s1 |
| InChIKey | IXSNBOLCXPLPOH-ULDDCMADSA-N |
| XLogP | 3.60 |
| TPSA | 111.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.50 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|