C23H28F3N4O3+ — CID 123318194
tert-butyl N-[4-(4-methyl-3,10-diaza-5-azoniatricyclo[5.2.1.02,5]deca-2(5),3-dien-10-yl)-4-oxo-1-(2,4,5-trifluorophenyl)butan-2-yl]carbamate (PubChem CID 123318194) has the molecular formula C23H28F3N4O3+ and a molecular weight of 465.50 g/mol. Its IUPAC name is tert-butyl N-[4-(4-methyl-3,10-diaza-5-azoniatricyclo[5.2.1.02,5]deca-2(5),3-dien-10-yl)-4-oxo-1-(2,4,5-trifluorophenyl)butan-2-yl]carbamate.
| Compound Name | tert-butyl N-[4-(4-methyl-3,10-diaza-5-azoniatricyclo[5.2.1.02,5]deca-2(5),3-dien-10-yl)-4-oxo-1-(2,4,5-trifluorophenyl)butan-2-yl]carbamate |
|---|---|
| PubChem CID | 123318194 |
| Molecular Formula | C23H28F3N4O3+ |
| Molecular Weight | 465.50 g/mol |
| Exact Mass | 465.21 |
| IUPAC Name | tert-butyl N-[4-(4-methyl-3,10-diaza-5-azoniatricyclo[5.2.1.02,5]deca-2(5),3-dien-10-yl)-4-oxo-1-(2,4,5-trifluorophenyl)butan-2-yl]carbamate |
| SMILES | CC1=NC2=[N+]1CC1CCC2N1C(=O)CC(Cc1cc(F)c(F)cc1F)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H27F3N4O3/c1-12-27-21-19-6-5-15(11-29(12)21)30(19)20(31)9-14(28-22(32)33-23(2,3)4)7-13-8-17(25)18(26)10-16(13)24/h8,10,14-15,19H,5-7,9,11H2,1-4H3/p+1 |
| InChIKey | NPYFIMTYNFZRIT-UHFFFAOYSA-O |
| XLogP | 3.15 |
| TPSA | 74.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.50 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|