C17H16F3NO3 — CID 92982616
(3S)-3-(phenylmethoxyamino)-4-(2,4,5-trifluorophenyl)butanoic acid (PubChem CID 92982616) has the molecular formula C17H16F3NO3 and a molecular weight of 339.31 g/mol. Its IUPAC name is (3S)-3-(phenylmethoxyamino)-4-(2,4,5-trifluorophenyl)butanoic acid.
| Compound Name | (3S)-3-(phenylmethoxyamino)-4-(2,4,5-trifluorophenyl)butanoic acid |
|---|---|
| PubChem CID | 92982616 |
| Molecular Formula | C17H16F3NO3 |
| Molecular Weight | 339.31 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | (3S)-3-(phenylmethoxyamino)-4-(2,4,5-trifluorophenyl)butanoic acid |
| SMILES | O=C(O)C[C@H](Cc1cc(F)c(F)cc1F)NOCc1ccccc1 |
| InChI | InChI=1S/C17H16F3NO3/c18-14-9-16(20)15(19)7-12(14)6-13(8-17(22)23)21-24-10-11-4-2-1-3-5-11/h1-5,7,9,13,21H,6,8,10H2,(H,22,23)/t13-/m0/s1 |
| InChIKey | WNCDQXXKCXRWRC-ZDUSSCGKSA-N |
| XLogP | 3.21 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.31 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|