C26H25F6N5O5 — CID 129277391
oxalic acid;(3R)-3-[[(1S)-1-phenylethyl]amino]-1-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-4-(2,4,5-trifluorophenyl)butan-1-one (PubChem CID 129277391) has the molecular formula C26H25F6N5O5 and a molecular weight of 601.50 g/mol. Its IUPAC name is oxalic acid;(3R)-3-[[(1S)-1-phenylethyl]amino]-1-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-4-(2,4,5-trifluorophenyl)butan-1-one.
| Compound Name | oxalic acid;(3R)-3-[[(1S)-1-phenylethyl]amino]-1-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-4-(2,4,5-trifluorophenyl)butan-1-one |
|---|---|
| PubChem CID | 129277391 |
| Molecular Formula | C26H25F6N5O5 |
| Molecular Weight | 601.50 g/mol |
| Exact Mass | 601.18 |
| IUPAC Name | oxalic acid;(3R)-3-[[(1S)-1-phenylethyl]amino]-1-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-4-(2,4,5-trifluorophenyl)butan-1-one |
| SMILES | C[C@H](N[C@@H](CC(=O)N1CCn2c(nnc2C(F)(F)F)C1)Cc1cc(F)c(F)cc1F)c1ccccc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C24H23F6N5O.C2H2O4/c1-14(15-5-3-2-4-6-15)31-17(9-16-10-19(26)20(27)12-18(16)25)11-22(36)34-7-8-35-21(13-34)32-33-23(35)24(28,29)30;3-1(4)2(5)6/h2-6,10,12,14,17,31H,7-9,11,13H2,1H3;(H,3,4)(H,5,6)/t14-,17+;/m0./s1 |
| InChIKey | MHZPUAMTFJUHMI-SQQLFYIASA-N |
| XLogP | 3.56 |
| TPSA | 137.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.50 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|