C24H29F6N7O3 — CID 56650604
2-amino-3-methyl-N-[1-oxo-1-[[(2R)-4-oxo-4-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-1-(2,4,5-trifluorophenyl)butan-2-yl]amino]propan-2-yl]butanamide (PubChem CID 56650604) has the molecular formula C24H29F6N7O3 and a molecular weight of 577.53 g/mol. Its IUPAC name is 2-amino-3-methyl-N-[1-oxo-1-[[(2R)-4-oxo-4-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-1-(2,4,5-trifluorophenyl)butan-2-yl]amino]propan-2-yl]butanamide.
| Compound Name | 2-amino-3-methyl-N-[1-oxo-1-[[(2R)-4-oxo-4-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-1-(2,4,5-trifluorophenyl)butan-2-yl]amino]propan-2-yl]butanamide |
|---|---|
| PubChem CID | 56650604 |
| Molecular Formula | C24H29F6N7O3 |
| Molecular Weight | 577.53 g/mol |
| Exact Mass | 577.22 |
| IUPAC Name | 2-amino-3-methyl-N-[1-oxo-1-[[(2R)-4-oxo-4-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-1-(2,4,5-trifluorophenyl)butan-2-yl]amino]propan-2-yl]butanamide |
| SMILES | CC(NC(=O)C(N)C(C)C)C(=O)N[C@@H](CC(=O)N1CCn2c(nnc2C(F)(F)F)C1)Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C24H29F6N7O3/c1-11(2)20(31)22(40)32-12(3)21(39)33-14(6-13-7-16(26)17(27)9-15(13)25)8-19(38)36-4-5-37-18(10-36)34-35-23(37)24(28,29)30/h7,9,11-12,14,20H,4-6,8,10,31H2,1-3H3,(H,32,40)(H,33,39)/t12?,14-,20?/m1/s1 |
| InChIKey | WLXYGKWVLVEJRP-HHGQXBFMSA-N |
| XLogP | 1.66 |
| TPSA | 135.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.53 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|