C23H21F6N5O — CID 123748342
3-(benzylamino)-1-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-4-(2,4,5-trifluorophenyl)butan-1-one (PubChem CID 123748342) has the molecular formula C23H21F6N5O and a molecular weight of 497.44 g/mol. Its IUPAC name is 3-(benzylamino)-1-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-4-(2,4,5-trifluorophenyl)butan-1-one.
| Compound Name | 3-(benzylamino)-1-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-4-(2,4,5-trifluorophenyl)butan-1-one |
|---|---|
| PubChem CID | 123748342 |
| Molecular Formula | C23H21F6N5O |
| Molecular Weight | 497.44 g/mol |
| Exact Mass | 497.17 |
| IUPAC Name | 3-(benzylamino)-1-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-4-(2,4,5-trifluorophenyl)butan-1-one |
| SMILES | O=C(CC(Cc1cc(F)c(F)cc1F)NCc1ccccc1)N1CCn2c(nnc2C(F)(F)F)C1 |
| InChI | InChI=1S/C23H21F6N5O/c24-17-11-19(26)18(25)9-15(17)8-16(30-12-14-4-2-1-3-5-14)10-21(35)33-6-7-34-20(13-33)31-32-22(34)23(27,28)29/h1-5,9,11,16,30H,6-8,10,12-13H2 |
| InChIKey | PZYMZELQJYLICB-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.44 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|