C24H24F6N6O2 — CID 141473204
(1R)-1-[[[(2R)-4-oxo-4-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-1-(2,4,5-trifluorophenyl)butan-2-yl]amino]methyl]cyclohexa-2,4-diene-1-carboxamide (PubChem CID 141473204) has the molecular formula C24H24F6N6O2 and a molecular weight of 542.48 g/mol. Its IUPAC name is (1R)-1-[[[(2R)-4-oxo-4-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-1-(2,4,5-trifluorophenyl)butan-2-yl]amino]methyl]cyclohexa-2,4-diene-1-carboxamide.
| Compound Name | (1R)-1-[[[(2R)-4-oxo-4-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-1-(2,4,5-trifluorophenyl)butan-2-yl]amino]methyl]cyclohexa-2,4-diene-1-carboxamide |
|---|---|
| PubChem CID | 141473204 |
| Molecular Formula | C24H24F6N6O2 |
| Molecular Weight | 542.48 g/mol |
| Exact Mass | 542.19 |
| IUPAC Name | (1R)-1-[[[(2R)-4-oxo-4-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-1-(2,4,5-trifluorophenyl)butan-2-yl]amino]methyl]cyclohexa-2,4-diene-1-carboxamide |
| SMILES | NC(=O)[C@@]1(CN[C@@H](CC(=O)N2CCn3c(nnc3C(F)(F)F)C2)Cc2cc(F)c(F)cc2F)C=CC=CC1 |
| InChI | InChI=1S/C24H24F6N6O2/c25-16-11-18(27)17(26)9-14(16)8-15(32-13-23(21(31)38)4-2-1-3-5-23)10-20(37)35-6-7-36-19(12-35)33-34-22(36)24(28,29)30/h1-4,9,11,15,32H,5-8,10,12-13H2,(H2,31,38)/t15-,23+/m1/s1 |
| InChIKey | OTWLJOJQTFUXQF-CMJOXMDJSA-N |
| XLogP | 2.64 |
| TPSA | 106.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.48 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|