C21H24F6N6O2 — CID 53476148
2-amino-3-methyl-N-[4-oxo-4-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-1-(2,4,5-trifluorophenyl)butan-2-yl]butanamide (PubChem CID 53476148) has the molecular formula C21H24F6N6O2 and a molecular weight of 506.45 g/mol. Its IUPAC name is 2-amino-3-methyl-N-[4-oxo-4-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-1-(2,4,5-trifluorophenyl)butan-2-yl]butanamide.
| Compound Name | 2-amino-3-methyl-N-[4-oxo-4-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-1-(2,4,5-trifluorophenyl)butan-2-yl]butanamide |
|---|---|
| PubChem CID | 53476148 |
| Molecular Formula | C21H24F6N6O2 |
| Molecular Weight | 506.45 g/mol |
| Exact Mass | 506.19 |
| IUPAC Name | 2-amino-3-methyl-N-[4-oxo-4-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-1-(2,4,5-trifluorophenyl)butan-2-yl]butanamide |
| SMILES | CC(C)C(N)C(=O)NC(CC(=O)N1CCn2c(nnc2C(F)(F)F)C1)Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C21H24F6N6O2/c1-10(2)18(28)19(35)29-12(5-11-6-14(23)15(24)8-13(11)22)7-17(34)32-3-4-33-16(9-32)30-31-20(33)21(25,26)27/h6,8,10,12,18H,3-5,7,9,28H2,1-2H3,(H,29,35) |
| InChIKey | BXVMUNIYUGYLAV-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 106.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.45 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|