C19H24ClNO2 — CID 66782242
2-[3-[(2S)-2-[[(1S)-1-phenylethyl]amino]propyl]phenyl]acetic acid;hydrochloride (PubChem CID 66782242) has the molecular formula C19H24ClNO2 and a molecular weight of 333.86 g/mol. Its IUPAC name is 2-[3-[(2S)-2-[[(1S)-1-phenylethyl]amino]propyl]phenyl]acetic acid;hydrochloride.
| Compound Name | 2-[3-[(2S)-2-[[(1S)-1-phenylethyl]amino]propyl]phenyl]acetic acid;hydrochloride |
|---|---|
| PubChem CID | 66782242 |
| Molecular Formula | C19H24ClNO2 |
| Molecular Weight | 333.86 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | 2-[3-[(2S)-2-[[(1S)-1-phenylethyl]amino]propyl]phenyl]acetic acid;hydrochloride |
| SMILES | C[C@H](N[C@@H](C)Cc1cccc(CC(=O)O)c1)c1ccccc1.Cl |
| InChI | InChI=1S/C19H23NO2.ClH/c1-14(20-15(2)18-9-4-3-5-10-18)11-16-7-6-8-17(12-16)13-19(21)22;/h3-10,12,14-15,20H,11,13H2,1-2H3,(H,21,22);1H/t14-,15-;/m0./s1 |
| InChIKey | IGSZEJQIMFPNLI-YYLIZZNMSA-N |
| XLogP | 4.02 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.86 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |