C20H26ClNO2 — CID 46938908
methyl 2-[3-[(2R)-2-[[(1R)-1-phenylethyl]amino]propyl]phenyl]acetate;hydrochloride (PubChem CID 46938908) has the molecular formula C20H26ClNO2 and a molecular weight of 347.89 g/mol. Its IUPAC name is methyl 2-[3-[(2R)-2-[[(1R)-1-phenylethyl]amino]propyl]phenyl]acetate;hydrochloride.
| Compound Name | methyl 2-[3-[(2R)-2-[[(1R)-1-phenylethyl]amino]propyl]phenyl]acetate;hydrochloride |
|---|---|
| PubChem CID | 46938908 |
| Molecular Formula | C20H26ClNO2 |
| Molecular Weight | 347.89 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | methyl 2-[3-[(2R)-2-[[(1R)-1-phenylethyl]amino]propyl]phenyl]acetate;hydrochloride |
| SMILES | COC(=O)Cc1cccc(C[C@@H](C)N[C@H](C)c2ccccc2)c1.Cl |
| InChI | InChI=1S/C20H25NO2.ClH/c1-15(21-16(2)19-10-5-4-6-11-19)12-17-8-7-9-18(13-17)14-20(22)23-3;/h4-11,13,15-16,21H,12,14H2,1-3H3;1H/t15-,16-;/m1./s1 |
| InChIKey | JNTKZSCMCFEPFO-QNBGGDODSA-N |
| XLogP | 4.11 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.89 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |