C24H34N2O2 — CID 66781839
tert-butyl N-[2-[3-[2-[[(1R)-1-phenylethyl]amino]propyl]phenyl]ethyl]carbamate (PubChem CID 66781839) has the molecular formula C24H34N2O2 and a molecular weight of 382.55 g/mol. Its IUPAC name is tert-butyl N-[2-[3-[2-[[(1R)-1-phenylethyl]amino]propyl]phenyl]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[3-[2-[[(1R)-1-phenylethyl]amino]propyl]phenyl]ethyl]carbamate |
|---|---|
| PubChem CID | 66781839 |
| Molecular Formula | C24H34N2O2 |
| Molecular Weight | 382.55 g/mol |
| Exact Mass | 382.26 |
| IUPAC Name | tert-butyl N-[2-[3-[2-[[(1R)-1-phenylethyl]amino]propyl]phenyl]ethyl]carbamate |
| SMILES | CC(Cc1cccc(CCNC(=O)OC(C)(C)C)c1)N[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C24H34N2O2/c1-18(26-19(2)22-12-7-6-8-13-22)16-21-11-9-10-20(17-21)14-15-25-23(27)28-24(3,4)5/h6-13,17-19,26H,14-16H2,1-5H3,(H,25,27)/t18?,19-/m1/s1 |
| InChIKey | GHNIITGPCSFAHU-MUMRKEEXSA-N |
| XLogP | 5.04 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.55 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |