C23H30N2O4 — CID 69064969
benzyl N-[2-[4-[1-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]phenyl]ethyl]carbamate (PubChem CID 69064969) has the molecular formula C23H30N2O4 and a molecular weight of 398.50 g/mol. Its IUPAC name is benzyl N-[2-[4-[1-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]phenyl]ethyl]carbamate.
| Compound Name | benzyl N-[2-[4-[1-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]phenyl]ethyl]carbamate |
|---|---|
| PubChem CID | 69064969 |
| Molecular Formula | C23H30N2O4 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.22 |
| IUPAC Name | benzyl N-[2-[4-[1-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]phenyl]ethyl]carbamate |
| SMILES | CC(NC(=O)OC(C)(C)C)c1ccc(CCNC(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C23H30N2O4/c1-17(25-22(27)29-23(2,3)4)20-12-10-18(11-13-20)14-15-24-21(26)28-16-19-8-6-5-7-9-19/h5-13,17H,14-16H2,1-4H3,(H,24,26)(H,25,27) |
| InChIKey | CYISETQFXRMQJY-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |