C15H25ClN2O2 — CID 67829395
[(2S)-3-carboxy-2-[[(1S)-1-phenylethyl]amino]propyl]-trimethylazanium chloride (PubChem CID 67829395) has the molecular formula C15H25ClN2O2 and a molecular weight of 300.83 g/mol. Its IUPAC name is [(2S)-3-carboxy-2-[[(1S)-1-phenylethyl]amino]propyl]-trimethylazanium chloride.
| Compound Name | [(2S)-3-carboxy-2-[[(1S)-1-phenylethyl]amino]propyl]-trimethylazanium chloride |
|---|---|
| PubChem CID | 67829395 |
| Molecular Formula | C15H25ClN2O2 |
| Molecular Weight | 300.83 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | [(2S)-3-carboxy-2-[[(1S)-1-phenylethyl]amino]propyl]-trimethylazanium chloride |
| SMILES | C[C@H](N[C@@H](CC(=O)O)C[N+](C)(C)C)c1ccccc1.[Cl-] |
| InChI | InChI=1S/C15H24N2O2.ClH/c1-12(13-8-6-5-7-9-13)16-14(10-15(18)19)11-17(2,3)4;/h5-9,12,14,16H,10-11H2,1-4H3;1H/t12-,14-;/m0./s1 |
| InChIKey | CWOOKIQLRFRPIV-KYSPHBLOSA-N |
| XLogP | -1.11 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.83 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|