C25H29N3O3 — CID 11327592
2-[4-[(4aR)-9-methoxy-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinolin-3-yl]butyl]isoindole-1,3-dione (PubChem CID 11327592) has the molecular formula C25H29N3O3 and a molecular weight of 419.53 g/mol. Its IUPAC name is 2-[4-[(4aR)-9-methoxy-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinolin-3-yl]butyl]isoindole-1,3-dione.
| Compound Name | 2-[4-[(4aR)-9-methoxy-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinolin-3-yl]butyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 11327592 |
| Molecular Formula | C25H29N3O3 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | 2-[4-[(4aR)-9-methoxy-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinolin-3-yl]butyl]isoindole-1,3-dione |
| SMILES | COc1ccc2c(c1)N1CCN(CCCCN3C(=O)c4ccccc4C3=O)C[C@H]1CC2 |
| InChI | InChI=1S/C25H29N3O3/c1-31-20-11-9-18-8-10-19-17-26(14-15-27(19)23(18)16-20)12-4-5-13-28-24(29)21-6-2-3-7-22(21)25(28)30/h2-3,6-7,9,11,16,19H,4-5,8,10,12-15,17H2,1H3/t19-/m1/s1 |
| InChIKey | ZIAKSYZKSBGFMN-LJQANCHMSA-N |
| XLogP | 3.21 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|