C27H28N6O3 — CID 39540741
2-(2-methylphenyl)-1,3-dioxo-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]isoindole-5-carboxamide (PubChem CID 39540741) has the molecular formula C27H28N6O3 and a molecular weight of 484.56 g/mol. Its IUPAC name is 2-(2-methylphenyl)-1,3-dioxo-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]isoindole-5-carboxamide.
| Compound Name | 2-(2-methylphenyl)-1,3-dioxo-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]isoindole-5-carboxamide |
|---|---|
| PubChem CID | 39540741 |
| Molecular Formula | C27H28N6O3 |
| Molecular Weight | 484.56 g/mol |
| Exact Mass | 484.22 |
| IUPAC Name | 2-(2-methylphenyl)-1,3-dioxo-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]isoindole-5-carboxamide |
| SMILES | Cc1ccccc1N1C(=O)c2ccc(C(=O)NCCCN3CCN(c4ncccn4)CC3)cc2C1=O |
| InChI | InChI=1S/C27H28N6O3/c1-19-6-2-3-7-23(19)33-25(35)21-9-8-20(18-22(21)26(33)36)24(34)28-12-5-13-31-14-16-32(17-15-31)27-29-10-4-11-30-27/h2-4,6-11,18H,5,12-17H2,1H3,(H,28,34) |
| InChIKey | POSRDASISBCYQS-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.56 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|