C20H26N4O — CID 127042302
N-[3-[4-(2-methylphenyl)piperazin-1-yl]propyl]pyridine-4-carboxamide (PubChem CID 127042302) has the molecular formula C20H26N4O and a molecular weight of 338.46 g/mol. Its IUPAC name is N-[3-[4-(2-methylphenyl)piperazin-1-yl]propyl]pyridine-4-carboxamide.
| Compound Name | N-[3-[4-(2-methylphenyl)piperazin-1-yl]propyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 127042302 |
| Molecular Formula | C20H26N4O |
| Molecular Weight | 338.46 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | N-[3-[4-(2-methylphenyl)piperazin-1-yl]propyl]pyridine-4-carboxamide |
| SMILES | Cc1ccccc1N1CCN(CCCNC(=O)c2ccncc2)CC1 |
| InChI | InChI=1S/C20H26N4O/c1-17-5-2-3-6-19(17)24-15-13-23(14-16-24)12-4-9-22-20(25)18-7-10-21-11-8-18/h2-3,5-8,10-11H,4,9,12-16H2,1H3,(H,22,25) |
| InChIKey | ZYZNWUMYTUWBBM-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.46 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|