C19H23ClN6OS — CID 57181654
6-chloro-7-methyl-2-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]-4H-1,2,4-benzothiadiazin-3-one (PubChem CID 57181654) has the molecular formula C19H23ClN6OS and a molecular weight of 418.95 g/mol. Its IUPAC name is 6-chloro-7-methyl-2-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]-4H-1,2,4-benzothiadiazin-3-one.
| Compound Name | 6-chloro-7-methyl-2-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]-4H-1,2,4-benzothiadiazin-3-one |
|---|---|
| PubChem CID | 57181654 |
| Molecular Formula | C19H23ClN6OS |
| Molecular Weight | 418.95 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | 6-chloro-7-methyl-2-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]-4H-1,2,4-benzothiadiazin-3-one |
| SMILES | Cc1cc2c(cc1Cl)NC(=O)N(CCCN1CCN(c3ncccn3)CC1)S2 |
| InChI | InChI=1S/C19H23ClN6OS/c1-14-12-17-16(13-15(14)20)23-19(27)26(28-17)7-3-6-24-8-10-25(11-9-24)18-21-4-2-5-22-18/h2,4-5,12-13H,3,6-11H2,1H3,(H,23,27) |
| InChIKey | DLYMUSQLKIFUJL-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.95 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|