C20H23F3N6OS — CID 57300670
2-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]-7-(trifluoromethyl)-4H-1,2,4-benzothiadiazin-3-one (PubChem CID 57300670) has the molecular formula C20H23F3N6OS and a molecular weight of 452.51 g/mol. Its IUPAC name is 2-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]-7-(trifluoromethyl)-4H-1,2,4-benzothiadiazin-3-one.
| Compound Name | 2-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]-7-(trifluoromethyl)-4H-1,2,4-benzothiadiazin-3-one |
|---|---|
| PubChem CID | 57300670 |
| Molecular Formula | C20H23F3N6OS |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.16 |
| IUPAC Name | 2-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]-7-(trifluoromethyl)-4H-1,2,4-benzothiadiazin-3-one |
| SMILES | O=C1Nc2ccc(C(F)(F)F)cc2SN1CCCCN1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C20H23F3N6OS/c21-20(22,23)15-4-5-16-17(14-15)31-29(19(30)26-16)9-2-1-8-27-10-12-28(13-11-27)18-24-6-3-7-25-18/h3-7,14H,1-2,8-13H2,(H,26,30) |
| InChIKey | CNCCIDHNLLRESW-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|