C17H23F3N6 — CID 15788035
2-[4-[4-[3-methyl-5-(trifluoromethyl)pyrazol-1-yl]butyl]piperazin-1-yl]pyrimidine (PubChem CID 15788035) has the molecular formula C17H23F3N6 and a molecular weight of 368.41 g/mol. Its IUPAC name is 2-[4-[4-[3-methyl-5-(trifluoromethyl)pyrazol-1-yl]butyl]piperazin-1-yl]pyrimidine.
| Compound Name | 2-[4-[4-[3-methyl-5-(trifluoromethyl)pyrazol-1-yl]butyl]piperazin-1-yl]pyrimidine |
|---|---|
| PubChem CID | 15788035 |
| Molecular Formula | C17H23F3N6 |
| Molecular Weight | 368.41 g/mol |
| Exact Mass | 368.19 |
| IUPAC Name | 2-[4-[4-[3-methyl-5-(trifluoromethyl)pyrazol-1-yl]butyl]piperazin-1-yl]pyrimidine |
| SMILES | Cc1cc(C(F)(F)F)n(CCCCN2CCN(c3ncccn3)CC2)n1 |
| InChI | InChI=1S/C17H23F3N6/c1-14-13-15(17(18,19)20)26(23-14)8-3-2-7-24-9-11-25(12-10-24)16-21-5-4-6-22-16/h4-6,13H,2-3,7-12H2,1H3 |
| InChIKey | BYTHCFMVKXRCBZ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.41 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|