C18H26N6O — CID 139654545
2,3-dimethyl-5-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butoxy]pyrazine (PubChem CID 139654545) has the molecular formula C18H26N6O and a molecular weight of 342.45 g/mol. Its IUPAC name is 2,3-dimethyl-5-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butoxy]pyrazine.
| Compound Name | 2,3-dimethyl-5-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butoxy]pyrazine |
|---|---|
| PubChem CID | 139654545 |
| Molecular Formula | C18H26N6O |
| Molecular Weight | 342.45 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | 2,3-dimethyl-5-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butoxy]pyrazine |
| SMILES | Cc1ncc(OCCCCN2CCN(c3ncccn3)CC2)nc1C |
| InChI | InChI=1S/C18H26N6O/c1-15-16(2)22-17(14-21-15)25-13-4-3-8-23-9-11-24(12-10-23)18-19-6-5-7-20-18/h5-7,14H,3-4,8-13H2,1-2H3 |
| InChIKey | GVBXOQLIBWCESI-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 67.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.45 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|