C20H27FN4O — CID 139654537
5-[4-[4-(2-fluorophenyl)piperazin-1-yl]butoxy]-2,3-dimethylpyrazine (PubChem CID 139654537) has the molecular formula C20H27FN4O and a molecular weight of 358.46 g/mol. Its IUPAC name is 5-[4-[4-(2-fluorophenyl)piperazin-1-yl]butoxy]-2,3-dimethylpyrazine.
| Compound Name | 5-[4-[4-(2-fluorophenyl)piperazin-1-yl]butoxy]-2,3-dimethylpyrazine |
|---|---|
| PubChem CID | 139654537 |
| Molecular Formula | C20H27FN4O |
| Molecular Weight | 358.46 g/mol |
| Exact Mass | 358.22 |
| IUPAC Name | 5-[4-[4-(2-fluorophenyl)piperazin-1-yl]butoxy]-2,3-dimethylpyrazine |
| SMILES | Cc1ncc(OCCCCN2CCN(c3ccccc3F)CC2)nc1C |
| InChI | InChI=1S/C20H27FN4O/c1-16-17(2)23-20(15-22-16)26-14-6-5-9-24-10-12-25(13-11-24)19-8-4-3-7-18(19)21/h3-4,7-8,15H,5-6,9-14H2,1-2H3 |
| InChIKey | MQAXQRFYFFKFKY-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 41.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.46 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|