C20H30N6O3 — CID 139654546
2-[4-[4-(5,6-dimethylpyrazin-2-yl)oxybutyl]piperazin-1-yl]-4,6-dimethoxypyrimidine (PubChem CID 139654546) has the molecular formula C20H30N6O3 and a molecular weight of 402.50 g/mol. Its IUPAC name is 2-[4-[4-(5,6-dimethylpyrazin-2-yl)oxybutyl]piperazin-1-yl]-4,6-dimethoxypyrimidine.
| Compound Name | 2-[4-[4-(5,6-dimethylpyrazin-2-yl)oxybutyl]piperazin-1-yl]-4,6-dimethoxypyrimidine |
|---|---|
| PubChem CID | 139654546 |
| Molecular Formula | C20H30N6O3 |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.24 |
| IUPAC Name | 2-[4-[4-(5,6-dimethylpyrazin-2-yl)oxybutyl]piperazin-1-yl]-4,6-dimethoxypyrimidine |
| SMILES | COc1cc(OC)nc(N2CCN(CCCCOc3cnc(C)c(C)n3)CC2)n1 |
| InChI | InChI=1S/C20H30N6O3/c1-15-16(2)22-19(14-21-15)29-12-6-5-7-25-8-10-26(11-9-25)20-23-17(27-3)13-18(24-20)28-4/h13-14H,5-12H2,1-4H3 |
| InChIKey | YDPOXGRNRTZOMM-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 85.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|