C21H30N6O — CID 23368036
2-[4-[4-(4-methylpyrimidin-2-yl)piperazin-1-yl]butoxy]-5,6,7,8-tetrahydroquinoxaline (PubChem CID 23368036) has the molecular formula C21H30N6O and a molecular weight of 382.51 g/mol. Its IUPAC name is 2-[4-[4-(4-methylpyrimidin-2-yl)piperazin-1-yl]butoxy]-5,6,7,8-tetrahydroquinoxaline.
| Compound Name | 2-[4-[4-(4-methylpyrimidin-2-yl)piperazin-1-yl]butoxy]-5,6,7,8-tetrahydroquinoxaline |
|---|---|
| PubChem CID | 23368036 |
| Molecular Formula | C21H30N6O |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.25 |
| IUPAC Name | 2-[4-[4-(4-methylpyrimidin-2-yl)piperazin-1-yl]butoxy]-5,6,7,8-tetrahydroquinoxaline |
| SMILES | Cc1ccnc(N2CCN(CCCCOc3cnc4c(n3)CCCC4)CC2)n1 |
| InChI | InChI=1S/C21H30N6O/c1-17-8-9-22-21(24-17)27-13-11-26(12-14-27)10-4-5-15-28-20-16-23-18-6-2-3-7-19(18)25-20/h8-9,16H,2-7,10-15H2,1H3 |
| InChIKey | AMSVSGPJMAVEOZ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 67.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|