C15H27N5O — CID 115974288
4-[4-(4-ethoxypyrimidin-2-yl)-1,4-diazepan-1-yl]butan-1-amine (PubChem CID 115974288) has the molecular formula C15H27N5O and a molecular weight of 293.41 g/mol. Its IUPAC name is 4-[4-(4-ethoxypyrimidin-2-yl)-1,4-diazepan-1-yl]butan-1-amine.
| Compound Name | 4-[4-(4-ethoxypyrimidin-2-yl)-1,4-diazepan-1-yl]butan-1-amine |
|---|---|
| PubChem CID | 115974288 |
| Molecular Formula | C15H27N5O |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.22 |
| IUPAC Name | 4-[4-(4-ethoxypyrimidin-2-yl)-1,4-diazepan-1-yl]butan-1-amine |
| SMILES | CCOc1ccnc(N2CCCN(CCCCN)CC2)n1 |
| InChI | InChI=1S/C15H27N5O/c1-2-21-14-6-8-17-15(18-14)20-11-5-10-19(12-13-20)9-4-3-7-16/h6,8H,2-5,7,9-13,16H2,1H3 |
| InChIKey | MDSMFLRWXXOSHJ-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|