C14H24IN5 — CID 116648245
5-[4-(5-iodopyrimidin-2-yl)-1,4-diazepan-1-yl]pentan-1-amine (PubChem CID 116648245) has the molecular formula C14H24IN5 and a molecular weight of 389.29 g/mol. Its IUPAC name is 5-[4-(5-iodopyrimidin-2-yl)-1,4-diazepan-1-yl]pentan-1-amine.
| Compound Name | 5-[4-(5-iodopyrimidin-2-yl)-1,4-diazepan-1-yl]pentan-1-amine |
|---|---|
| PubChem CID | 116648245 |
| Molecular Formula | C14H24IN5 |
| Molecular Weight | 389.29 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | 5-[4-(5-iodopyrimidin-2-yl)-1,4-diazepan-1-yl]pentan-1-amine |
| SMILES | NCCCCCN1CCCN(c2ncc(I)cn2)CC1 |
| InChI | InChI=1S/C14H24IN5/c15-13-11-17-14(18-12-13)20-8-4-7-19(9-10-20)6-3-1-2-5-16/h11-12H,1-10,16H2 |
| InChIKey | STODPRIPKCBHKM-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.29 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|