C15H24F2N4 — CID 115993891
5-[4-(3,5-difluoro-2-pyridinyl)-1,4-diazepan-1-yl]pentan-1-amine (PubChem CID 115993891) has the molecular formula C15H24F2N4 and a molecular weight of 298.38 g/mol. Its IUPAC name is 5-[4-(3,5-difluoro-2-pyridinyl)-1,4-diazepan-1-yl]pentan-1-amine.
| Compound Name | 5-[4-(3,5-difluoro-2-pyridinyl)-1,4-diazepan-1-yl]pentan-1-amine |
|---|---|
| PubChem CID | 115993891 |
| Molecular Formula | C15H24F2N4 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.20 |
| IUPAC Name | 5-[4-(3,5-difluoro-2-pyridinyl)-1,4-diazepan-1-yl]pentan-1-amine |
| SMILES | NCCCCCN1CCCN(c2ncc(F)cc2F)CC1 |
| InChI | InChI=1S/C15H24F2N4/c16-13-11-14(17)15(19-12-13)21-8-4-7-20(9-10-21)6-3-1-2-5-18/h11-12H,1-10,18H2 |
| InChIKey | WTAWQFWFGMCLSP-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|