C10H15N3 — CID 2772402
1-pyridin-2-yl-1,4-diazepane (PubChem CID 2772402) has the molecular formula C10H15N3 and a molecular weight of 177.25 g/mol. Its IUPAC name is 1-pyridin-2-yl-1,4-diazepane.
| Compound Name | 1-pyridin-2-yl-1,4-diazepane |
|---|---|
| PubChem CID | 2772402 |
| Molecular Formula | C10H15N3 |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.13 |
| IUPAC Name | 1-pyridin-2-yl-1,4-diazepane |
| SMILES | c1ccc(N2CCCNCC2)nc1 |
| InChI | InChI=1S/C10H15N3/c1-2-6-12-10(4-1)13-8-3-5-11-7-9-13/h1-2,4,6,11H,3,5,7-9H2 |
| InChIKey | YIVVBOYHOANILT-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |