C15H25BrN4 — CID 104776541
5-[4-(3-bromo-4-pyridinyl)-1,4-diazepan-1-yl]pentan-1-amine (PubChem CID 104776541) has the molecular formula C15H25BrN4 and a molecular weight of 341.30 g/mol. Its IUPAC name is 5-[4-(3-bromo-4-pyridinyl)-1,4-diazepan-1-yl]pentan-1-amine.
| Compound Name | 5-[4-(3-bromo-4-pyridinyl)-1,4-diazepan-1-yl]pentan-1-amine |
|---|---|
| PubChem CID | 104776541 |
| Molecular Formula | C15H25BrN4 |
| Molecular Weight | 341.30 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | 5-[4-(3-bromo-4-pyridinyl)-1,4-diazepan-1-yl]pentan-1-amine |
| SMILES | NCCCCCN1CCCN(c2ccncc2Br)CC1 |
| InChI | InChI=1S/C15H25BrN4/c16-14-13-18-7-5-15(14)20-10-4-9-19(11-12-20)8-3-1-2-6-17/h5,7,13H,1-4,6,8-12,17H2 |
| InChIKey | DPCIJBSBMSLDFH-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.30 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|