C16H28N4O — CID 106503661
5-[4-(5-methoxy-2-pyridinyl)-1,4-diazepan-1-yl]pentan-1-amine (PubChem CID 106503661) has the molecular formula C16H28N4O and a molecular weight of 292.43 g/mol. Its IUPAC name is 5-[4-(5-methoxy-2-pyridinyl)-1,4-diazepan-1-yl]pentan-1-amine.
| Compound Name | 5-[4-(5-methoxy-2-pyridinyl)-1,4-diazepan-1-yl]pentan-1-amine |
|---|---|
| PubChem CID | 106503661 |
| Molecular Formula | C16H28N4O |
| Molecular Weight | 292.43 g/mol |
| Exact Mass | 292.23 |
| IUPAC Name | 5-[4-(5-methoxy-2-pyridinyl)-1,4-diazepan-1-yl]pentan-1-amine |
| SMILES | COc1ccc(N2CCCN(CCCCCN)CC2)nc1 |
| InChI | InChI=1S/C16H28N4O/c1-21-15-6-7-16(18-14-15)20-11-5-10-19(12-13-20)9-4-2-3-8-17/h6-7,14H,2-5,8-13,17H2,1H3 |
| InChIKey | SNRYZGNRWPIQAX-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 54.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.43 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|