C19H24N4O3 — CID 122029405
3-[[4-(4-ethoxypyrimidin-2-yl)-1,4-diazepan-1-yl]methyl]benzoic acid (PubChem CID 122029405) has the molecular formula C19H24N4O3 and a molecular weight of 356.43 g/mol. Its IUPAC name is 3-[[4-(4-ethoxypyrimidin-2-yl)-1,4-diazepan-1-yl]methyl]benzoic acid.
| Compound Name | 3-[[4-(4-ethoxypyrimidin-2-yl)-1,4-diazepan-1-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 122029405 |
| Molecular Formula | C19H24N4O3 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | 3-[[4-(4-ethoxypyrimidin-2-yl)-1,4-diazepan-1-yl]methyl]benzoic acid |
| SMILES | CCOc1ccnc(N2CCCN(Cc3cccc(C(=O)O)c3)CC2)n1 |
| InChI | InChI=1S/C19H24N4O3/c1-2-26-17-7-8-20-19(21-17)23-10-4-9-22(11-12-23)14-15-5-3-6-16(13-15)18(24)25/h3,5-8,13H,2,4,9-12,14H2,1H3,(H,24,25) |
| InChIKey | PYJJCIJISDNEKU-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |