C28H35N5O2 — CID 139670744
2-[4-[4-[6-(4-methylphenoxy)-2-pyridinyl]piperazin-1-yl]butoxy]-5,6,7,8-tetrahydroquinoxaline (PubChem CID 139670744) has the molecular formula C28H35N5O2 and a molecular weight of 473.62 g/mol. Its IUPAC name is 2-[4-[4-[6-(4-methylphenoxy)-2-pyridinyl]piperazin-1-yl]butoxy]-5,6,7,8-tetrahydroquinoxaline.
| Compound Name | 2-[4-[4-[6-(4-methylphenoxy)-2-pyridinyl]piperazin-1-yl]butoxy]-5,6,7,8-tetrahydroquinoxaline |
|---|---|
| PubChem CID | 139670744 |
| Molecular Formula | C28H35N5O2 |
| Molecular Weight | 473.62 g/mol |
| Exact Mass | 473.28 |
| IUPAC Name | 2-[4-[4-[6-(4-methylphenoxy)-2-pyridinyl]piperazin-1-yl]butoxy]-5,6,7,8-tetrahydroquinoxaline |
| SMILES | Cc1ccc(Oc2cccc(N3CCN(CCCCOc4cnc5c(n4)CCCC5)CC3)n2)cc1 |
| InChI | InChI=1S/C28H35N5O2/c1-22-11-13-23(14-12-22)35-27-10-6-9-26(31-27)33-18-16-32(17-19-33)15-4-5-20-34-28-21-29-24-7-2-3-8-25(24)30-28/h6,9-14,21H,2-5,7-8,15-20H2,1H3 |
| InChIKey | GTTRDVJVVYGDEF-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 63.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.62 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|