C23H26F3N5O2 — CID 13476607
3-phenyl-1-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]-3-(trifluoromethyl)pyrrolidine-2,5-dione (PubChem CID 13476607) has the molecular formula C23H26F3N5O2 and a molecular weight of 461.49 g/mol. Its IUPAC name is 3-phenyl-1-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]-3-(trifluoromethyl)pyrrolidine-2,5-dione.
| Compound Name | 3-phenyl-1-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]-3-(trifluoromethyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 13476607 |
| Molecular Formula | C23H26F3N5O2 |
| Molecular Weight | 461.49 g/mol |
| Exact Mass | 461.20 |
| IUPAC Name | 3-phenyl-1-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]-3-(trifluoromethyl)pyrrolidine-2,5-dione |
| SMILES | O=C1CC(c2ccccc2)(C(F)(F)F)C(=O)N1CCCCN1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C23H26F3N5O2/c24-23(25,26)22(18-7-2-1-3-8-18)17-19(32)31(20(22)33)12-5-4-11-29-13-15-30(16-14-29)21-27-9-6-10-28-21/h1-3,6-10H,4-5,11-17H2 |
| InChIKey | QRWDGQLEKSARJM-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 69.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.49 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|