C23H34Cl3N5O4 — CID 118387916
8-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]-8-azaspiro[4.5]decane-7,9-dione;2,2,2-trichloroethane-1,1-diol (PubChem CID 118387916) has the molecular formula C23H34Cl3N5O4 and a molecular weight of 550.92 g/mol. Its IUPAC name is 8-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]-8-azaspiro[4.5]decane-7,9-dione;2,2,2-trichloroethane-1,1-diol.
| Compound Name | 8-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]-8-azaspiro[4.5]decane-7,9-dione;2,2,2-trichloroethane-1,1-diol |
|---|---|
| PubChem CID | 118387916 |
| Molecular Formula | C23H34Cl3N5O4 |
| Molecular Weight | 550.92 g/mol |
| Exact Mass | 549.17 |
| IUPAC Name | 8-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]-8-azaspiro[4.5]decane-7,9-dione;2,2,2-trichloroethane-1,1-diol |
| SMILES | O=C1CC2(CCCC2)CC(=O)N1CCCCN1CCN(c2ncccn2)CC1.OC(O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C21H31N5O2.C2H3Cl3O2/c27-18-16-21(6-1-2-7-21)17-19(28)26(18)11-4-3-10-24-12-14-25(15-13-24)20-22-8-5-9-23-20;3-2(4,5)1(6)7/h5,8-9H,1-4,6-7,10-17H2;1,6-7H |
| InChIKey | CJKVLVSJRONKJD-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 110.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.92 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|