C17H14N2O6S — CID 7767604
4-[[(3S)-2-methyl-1,1,4-trioxo-3H-1λ6,2-benzothiazine-3-carbonyl]amino]benzoic acid (PubChem CID 7767604) has the molecular formula C17H14N2O6S and a molecular weight of 374.37 g/mol. Its IUPAC name is 4-[[(3S)-2-methyl-1,1,4-trioxo-3H-1λ6,2-benzothiazine-3-carbonyl]amino]benzoic acid.
| Compound Name | 4-[[(3S)-2-methyl-1,1,4-trioxo-3H-1λ6,2-benzothiazine-3-carbonyl]amino]benzoic acid |
|---|---|
| PubChem CID | 7767604 |
| Molecular Formula | C17H14N2O6S |
| Molecular Weight | 374.37 g/mol |
| Exact Mass | 374.06 |
| IUPAC Name | 4-[[(3S)-2-methyl-1,1,4-trioxo-3H-1λ6,2-benzothiazine-3-carbonyl]amino]benzoic acid |
| SMILES | CN1[C@H](C(=O)Nc2ccc(C(=O)O)cc2)C(=O)c2ccccc2S1(=O)=O |
| InChI | InChI=1S/C17H14N2O6S/c1-19-14(15(20)12-4-2-3-5-13(12)26(19,24)25)16(21)18-11-8-6-10(7-9-11)17(22)23/h2-9,14H,1H3,(H,18,21)(H,22,23)/t14-/m0/s1 |
| InChIKey | CYPJNZFBIZNRKM-AWEZNQCLSA-N |
| XLogP | 1.21 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.37 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|