C20H16N4O4S — CID 7582851
(3R)-2-benzyl-1,1,4-trioxo-N-pyrimidin-2-yl-3H-1λ6,2-benzothiazine-3-carboxamide (PubChem CID 7582851) has the molecular formula C20H16N4O4S and a molecular weight of 408.44 g/mol. Its IUPAC name is (3R)-2-benzyl-1,1,4-trioxo-N-pyrimidin-2-yl-3H-1λ6,2-benzothiazine-3-carboxamide.
| Compound Name | (3R)-2-benzyl-1,1,4-trioxo-N-pyrimidin-2-yl-3H-1λ6,2-benzothiazine-3-carboxamide |
|---|---|
| PubChem CID | 7582851 |
| Molecular Formula | C20H16N4O4S |
| Molecular Weight | 408.44 g/mol |
| Exact Mass | 408.09 |
| IUPAC Name | (3R)-2-benzyl-1,1,4-trioxo-N-pyrimidin-2-yl-3H-1λ6,2-benzothiazine-3-carboxamide |
| SMILES | O=C(Nc1ncccn1)[C@H]1C(=O)c2ccccc2S(=O)(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C20H16N4O4S/c25-18-15-9-4-5-10-16(15)29(27,28)24(13-14-7-2-1-3-8-14)17(18)19(26)23-20-21-11-6-12-22-20/h1-12,17H,13H2,(H,21,22,23,26)/t17-/m1/s1 |
| InChIKey | FQUNEQPIXNKOSD-QGZVFWFLSA-N |
| XLogP | 1.87 |
| TPSA | 109.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.44 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|