C23H19NO6S — CID 91536395
methyl 1,1,4-trioxo-2-(2-phenylmethoxyphenyl)-3H-1λ6,2-benzothiazine-3-carboxylate (PubChem CID 91536395) has the molecular formula C23H19NO6S and a molecular weight of 437.47 g/mol. Its IUPAC name is methyl 1,1,4-trioxo-2-(2-phenylmethoxyphenyl)-3H-1λ6,2-benzothiazine-3-carboxylate.
| Compound Name | methyl 1,1,4-trioxo-2-(2-phenylmethoxyphenyl)-3H-1λ6,2-benzothiazine-3-carboxylate |
|---|---|
| PubChem CID | 91536395 |
| Molecular Formula | C23H19NO6S |
| Molecular Weight | 437.47 g/mol |
| Exact Mass | 437.09 |
| IUPAC Name | methyl 1,1,4-trioxo-2-(2-phenylmethoxyphenyl)-3H-1λ6,2-benzothiazine-3-carboxylate |
| SMILES | COC(=O)C1C(=O)c2ccccc2S(=O)(=O)N1c1ccccc1OCc1ccccc1 |
| InChI | InChI=1S/C23H19NO6S/c1-29-23(26)21-22(25)17-11-5-8-14-20(17)31(27,28)24(21)18-12-6-7-13-19(18)30-15-16-9-3-2-4-10-16/h2-14,21H,15H2,1H3 |
| InChIKey | LFFMBELXMSFSQD-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.47 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|