C17H14ClNO5S — CID 91386292
methyl 2-(3-chloro-2-methylphenyl)-1,1,4-trioxo-3H-1λ6,2-benzothiazine-3-carboxylate (PubChem CID 91386292) has the molecular formula C17H14ClNO5S and a molecular weight of 379.82 g/mol. Its IUPAC name is methyl 2-(3-chloro-2-methylphenyl)-1,1,4-trioxo-3H-1λ6,2-benzothiazine-3-carboxylate.
| Compound Name | methyl 2-(3-chloro-2-methylphenyl)-1,1,4-trioxo-3H-1λ6,2-benzothiazine-3-carboxylate |
|---|---|
| PubChem CID | 91386292 |
| Molecular Formula | C17H14ClNO5S |
| Molecular Weight | 379.82 g/mol |
| Exact Mass | 379.03 |
| IUPAC Name | methyl 2-(3-chloro-2-methylphenyl)-1,1,4-trioxo-3H-1λ6,2-benzothiazine-3-carboxylate |
| SMILES | COC(=O)C1C(=O)c2ccccc2S(=O)(=O)N1c1cccc(Cl)c1C |
| InChI | InChI=1S/C17H14ClNO5S/c1-10-12(18)7-5-8-13(10)19-15(17(21)24-2)16(20)11-6-3-4-9-14(11)25(19,22)23/h3-9,15H,1-2H3 |
| InChIKey | HWMXBBGZKBJKOG-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.82 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|