C13H10ClNO4S — CID 43835495
2-(2-chlorophenyl)-3-hydroperoxy-3H-1,2-benzothiazole 1,1-dioxide (PubChem CID 43835495) has the molecular formula C13H10ClNO4S and a molecular weight of 311.75 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-3-hydroperoxy-3H-1,2-benzothiazole 1,1-dioxide.
| Compound Name | 2-(2-chlorophenyl)-3-hydroperoxy-3H-1,2-benzothiazole 1,1-dioxide |
|---|---|
| PubChem CID | 43835495 |
| Molecular Formula | C13H10ClNO4S |
| Molecular Weight | 311.75 g/mol |
| Exact Mass | 311.00 |
| IUPAC Name | 2-(2-chlorophenyl)-3-hydroperoxy-3H-1,2-benzothiazole 1,1-dioxide |
| SMILES | O=S1(=O)c2ccccc2C(OO)N1c1ccccc1Cl |
| InChI | InChI=1S/C13H10ClNO4S/c14-10-6-2-3-7-11(10)15-13(19-16)9-5-1-4-8-12(9)20(15,17)18/h1-8,13,16H |
| InChIKey | OHPYSPJNQDNDOQ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.75 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|