C17H18ClNO4S — CID 10937476
11-chloro-6-(2-methoxyethoxymethyl)-11H-benzo[c][1,2]benzothiazepine 5,5-dioxide (PubChem CID 10937476) has the molecular formula C17H18ClNO4S and a molecular weight of 367.85 g/mol. Its IUPAC name is 11-chloro-6-(2-methoxyethoxymethyl)-11H-benzo[c][1,2]benzothiazepine 5,5-dioxide.
| Compound Name | 11-chloro-6-(2-methoxyethoxymethyl)-11H-benzo[c][1,2]benzothiazepine 5,5-dioxide |
|---|---|
| PubChem CID | 10937476 |
| Molecular Formula | C17H18ClNO4S |
| Molecular Weight | 367.85 g/mol |
| Exact Mass | 367.06 |
| IUPAC Name | 11-chloro-6-(2-methoxyethoxymethyl)-11H-benzo[c][1,2]benzothiazepine 5,5-dioxide |
| SMILES | COCCOCN1c2ccccc2C(Cl)c2ccccc2S1(=O)=O |
| InChI | InChI=1S/C17H18ClNO4S/c1-22-10-11-23-12-19-15-8-4-2-6-13(15)17(18)14-7-3-5-9-16(14)24(19,20)21/h2-9,17H,10-12H2,1H3 |
| InChIKey | UMBOYDFYDRKFGF-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.85 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|