C19H23ClN2O3S — CID 126713077
3-chloro-N-(4-methoxybutyl)-6-methyl-5,5-dioxo-11H-benzo[c][2,1]benzothiazepin-11-amine (PubChem CID 126713077) has the molecular formula C19H23ClN2O3S and a molecular weight of 394.92 g/mol. Its IUPAC name is 3-chloro-N-(4-methoxybutyl)-6-methyl-5,5-dioxo-11H-benzo[c][2,1]benzothiazepin-11-amine.
| Compound Name | 3-chloro-N-(4-methoxybutyl)-6-methyl-5,5-dioxo-11H-benzo[c][2,1]benzothiazepin-11-amine |
|---|---|
| PubChem CID | 126713077 |
| Molecular Formula | C19H23ClN2O3S |
| Molecular Weight | 394.92 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | 3-chloro-N-(4-methoxybutyl)-6-methyl-5,5-dioxo-11H-benzo[c][2,1]benzothiazepin-11-amine |
| SMILES | COCCCCNC1c2ccccc2N(C)S(=O)(=O)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C19H23ClN2O3S/c1-22-17-8-4-3-7-15(17)19(21-11-5-6-12-25-2)16-10-9-14(20)13-18(16)26(22,23)24/h3-4,7-10,13,19,21H,5-6,11-12H2,1-2H3 |
| InChIKey | FMUYRGADXYSSDY-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.92 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|