C20H25ClN2OS — CID 163239793
3-chloro-N-(5-methoxypentyl)-6-methyl-11H-benzo[c][2,1]benzothiazepin-11-amine (PubChem CID 163239793) has the molecular formula C20H25ClN2OS and a molecular weight of 376.95 g/mol. Its IUPAC name is 3-chloro-N-(5-methoxypentyl)-6-methyl-11H-benzo[c][2,1]benzothiazepin-11-amine.
| Compound Name | 3-chloro-N-(5-methoxypentyl)-6-methyl-11H-benzo[c][2,1]benzothiazepin-11-amine |
|---|---|
| PubChem CID | 163239793 |
| Molecular Formula | C20H25ClN2OS |
| Molecular Weight | 376.95 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | 3-chloro-N-(5-methoxypentyl)-6-methyl-11H-benzo[c][2,1]benzothiazepin-11-amine |
| SMILES | COCCCCCNC1c2ccc(Cl)cc2SN(C)c2ccccc21 |
| InChI | InChI=1S/C20H25ClN2OS/c1-23-18-9-5-4-8-16(18)20(22-12-6-3-7-13-24-2)17-11-10-15(21)14-19(17)25-23/h4-5,8-11,14,20,22H,3,6-7,12-13H2,1-2H3 |
| InChIKey | SQTMSCIMCVDFNZ-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.95 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|