C23H36N2OS — CID 145278037
ethane;N-(3-methoxypropyl)-3,6-dimethyl-11H-benzo[c][2,1]benzothiazepin-11-amine (PubChem CID 145278037) has the molecular formula C23H36N2OS and a molecular weight of 388.62 g/mol. Its IUPAC name is ethane;N-(3-methoxypropyl)-3,6-dimethyl-11H-benzo[c][2,1]benzothiazepin-11-amine.
| Compound Name | ethane;N-(3-methoxypropyl)-3,6-dimethyl-11H-benzo[c][2,1]benzothiazepin-11-amine |
|---|---|
| PubChem CID | 145278037 |
| Molecular Formula | C23H36N2OS |
| Molecular Weight | 388.62 g/mol |
| Exact Mass | 388.25 |
| IUPAC Name | ethane;N-(3-methoxypropyl)-3,6-dimethyl-11H-benzo[c][2,1]benzothiazepin-11-amine |
| SMILES | CC.CC.COCCCNC1c2ccc(C)cc2SN(C)c2ccccc21 |
| InChI | InChI=1S/C19H24N2OS.2C2H6/c1-14-9-10-16-18(13-14)23-21(2)17-8-5-4-7-15(17)19(16)20-11-6-12-22-3;2*1-2/h4-5,7-10,13,19-20H,6,11-12H2,1-3H3;2*1-2H3 |
| InChIKey | HGMYPFWSEJIBFM-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.62 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|