C16H20N2OS2 — CID 144921816
N-(3-methoxypropyl)-4-methyl-10H-thieno[3,2-c][1,2]benzothiazepin-10-amine (PubChem CID 144921816) has the molecular formula C16H20N2OS2 and a molecular weight of 320.48 g/mol. Its IUPAC name is N-(3-methoxypropyl)-4-methyl-10H-thieno[3,2-c][1,2]benzothiazepin-10-amine.
| Compound Name | N-(3-methoxypropyl)-4-methyl-10H-thieno[3,2-c][1,2]benzothiazepin-10-amine |
|---|---|
| PubChem CID | 144921816 |
| Molecular Formula | C16H20N2OS2 |
| Molecular Weight | 320.48 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | N-(3-methoxypropyl)-4-methyl-10H-thieno[3,2-c][1,2]benzothiazepin-10-amine |
| SMILES | COCCCNC1c2ccccc2SN(C)c2ccsc21 |
| InChI | InChI=1S/C16H20N2OS2/c1-18-13-8-11-20-16(13)15(17-9-5-10-19-2)12-6-3-4-7-14(12)21-18/h3-4,6-8,11,15,17H,5,9-10H2,1-2H3 |
| InChIKey | VSNMFTSMMXVRCH-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.48 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|