C13H19NO2 — CID 7287154
(4R)-N-(3-methoxypropyl)-3,4-dihydro-2H-chromen-4-amine (PubChem CID 7287154) has the molecular formula C13H19NO2 and a molecular weight of 221.30 g/mol. Its IUPAC name is (4R)-N-(3-methoxypropyl)-3,4-dihydro-2H-chromen-4-amine.
| Compound Name | (4R)-N-(3-methoxypropyl)-3,4-dihydro-2H-chromen-4-amine |
|---|---|
| PubChem CID | 7287154 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | (4R)-N-(3-methoxypropyl)-3,4-dihydro-2H-chromen-4-amine |
| SMILES | COCCCN[C@@H]1CCOc2ccccc21 |
| InChI | InChI=1S/C13H19NO2/c1-15-9-4-8-14-12-7-10-16-13-6-3-2-5-11(12)13/h2-3,5-6,12,14H,4,7-10H2,1H3/t12-/m1/s1 |
| InChIKey | FTPVIPPRGOQALE-GFCCVEGCSA-N |
| XLogP | 2.14 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|