C14H20N2O2S — CID 115571169
1-(3,4-dihydro-2H-chromen-4-yl)-3-(3-methoxypropyl)thiourea (PubChem CID 115571169) has the molecular formula C14H20N2O2S and a molecular weight of 280.39 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-chromen-4-yl)-3-(3-methoxypropyl)thiourea.
| Compound Name | 1-(3,4-dihydro-2H-chromen-4-yl)-3-(3-methoxypropyl)thiourea |
|---|---|
| PubChem CID | 115571169 |
| Molecular Formula | C14H20N2O2S |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | 1-(3,4-dihydro-2H-chromen-4-yl)-3-(3-methoxypropyl)thiourea |
| SMILES | COCCCNC(=S)NC1CCOc2ccccc21 |
| InChI | InChI=1S/C14H20N2O2S/c1-17-9-4-8-15-14(19)16-12-7-10-18-13-6-3-2-5-11(12)13/h2-3,5-6,12H,4,7-10H2,1H3,(H2,15,16,19) |
| InChIKey | MNSJJYGNLKKPJP-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|