C15H22N2OS — CID 115570802
1-(3-methoxypropyl)-3-(1,2,3,4-tetrahydronaphthalen-2-yl)thiourea (PubChem CID 115570802) has the molecular formula C15H22N2OS and a molecular weight of 278.42 g/mol. Its IUPAC name is 1-(3-methoxypropyl)-3-(1,2,3,4-tetrahydronaphthalen-2-yl)thiourea.
| Compound Name | 1-(3-methoxypropyl)-3-(1,2,3,4-tetrahydronaphthalen-2-yl)thiourea |
|---|---|
| PubChem CID | 115570802 |
| Molecular Formula | C15H22N2OS |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | 1-(3-methoxypropyl)-3-(1,2,3,4-tetrahydronaphthalen-2-yl)thiourea |
| SMILES | COCCCNC(=S)NC1CCc2ccccc2C1 |
| InChI | InChI=1S/C15H22N2OS/c1-18-10-4-9-16-15(19)17-14-8-7-12-5-2-3-6-13(12)11-14/h2-3,5-6,14H,4,7-11H2,1H3,(H2,16,17,19) |
| InChIKey | SFWQGQRXHMWGOG-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|