C21H24N2O3S — CID 86647746
2-[(7-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl)carbamothioylamino]ethyl benzoate (PubChem CID 86647746) has the molecular formula C21H24N2O3S and a molecular weight of 384.50 g/mol. Its IUPAC name is 2-[(7-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl)carbamothioylamino]ethyl benzoate.
| Compound Name | 2-[(7-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl)carbamothioylamino]ethyl benzoate |
|---|---|
| PubChem CID | 86647746 |
| Molecular Formula | C21H24N2O3S |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | 2-[(7-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl)carbamothioylamino]ethyl benzoate |
| SMILES | COc1ccc2c(c1)CC(NC(=S)NCCOC(=O)c1ccccc1)CC2 |
| InChI | InChI=1S/C21H24N2O3S/c1-25-19-10-8-15-7-9-18(13-17(15)14-19)23-21(27)22-11-12-26-20(24)16-5-3-2-4-6-16/h2-6,8,10,14,18H,7,9,11-13H2,1H3,(H2,22,23,27) |
| InChIKey | FPVRYVAWTKIPOW-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|