C9H17N3O2S — CID 106186223
1-(3-methoxypropyl)-3-(5-oxopyrrolidin-3-yl)thiourea (PubChem CID 106186223) has the molecular formula C9H17N3O2S and a molecular weight of 231.32 g/mol. Its IUPAC name is 1-(3-methoxypropyl)-3-(5-oxopyrrolidin-3-yl)thiourea.
| Compound Name | 1-(3-methoxypropyl)-3-(5-oxopyrrolidin-3-yl)thiourea |
|---|---|
| PubChem CID | 106186223 |
| Molecular Formula | C9H17N3O2S |
| Molecular Weight | 231.32 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | 1-(3-methoxypropyl)-3-(5-oxopyrrolidin-3-yl)thiourea |
| SMILES | COCCCNC(=S)NC1CNC(=O)C1 |
| InChI | InChI=1S/C9H17N3O2S/c1-14-4-2-3-10-9(15)12-7-5-8(13)11-6-7/h7H,2-6H2,1H3,(H,11,13)(H2,10,12,15) |
| InChIKey | NBVHBMWZBIYLRD-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.32 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|